C13H12ClN3O2S2 — CID 972287
1-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea (PubChem CID 972287) has the molecular formula C13H12ClN3O2S2 and a molecular weight of 341.85 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 972287 |
| Molecular Formula | C13H12ClN3O2S2 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea |
| SMILES | COc1ccc(Cl)cc1NC(=S)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H12ClN3O2S2/c1-19-10-5-4-8(14)7-9(10)15-13(20)17-16-12(18)11-3-2-6-21-11/h2-7H,1H3,(H,16,18)(H2,15,17,20) |
| InChIKey | GWJCTZLMKGXUSV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|