C15H17ClN2O2 — CID 97228806
(2S)-2-but-3-enoxy-N-(5-chloro-2-cyanophenyl)-N-methylpropanamide (PubChem CID 97228806) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is (2S)-2-but-3-enoxy-N-(5-chloro-2-cyanophenyl)-N-methylpropanamide.
| Compound Name | (2S)-2-but-3-enoxy-N-(5-chloro-2-cyanophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 97228806 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (2S)-2-but-3-enoxy-N-(5-chloro-2-cyanophenyl)-N-methylpropanamide |
| SMILES | C=CCCO[C@@H](C)C(=O)N(C)c1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C15H17ClN2O2/c1-4-5-8-20-11(2)15(19)18(3)14-9-13(16)7-6-12(14)10-17/h4,6-7,9,11H,1,5,8H2,2-3H3/t11-/m0/s1 |
| InChIKey | GSVYTXYMOPWPOS-NSHDSACASA-N |
| XLogP | 3.16 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|