C18H32N4 — CID 97228940
N-(3-imidazol-1-ylpropyl)-1-[(1R,3R)-3-methylcyclohexyl]piperidin-4-amine (PubChem CID 97228940) has the molecular formula C18H32N4 and a molecular weight of 304.48 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-1-[(1R,3R)-3-methylcyclohexyl]piperidin-4-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-1-[(1R,3R)-3-methylcyclohexyl]piperidin-4-amine |
|---|---|
| PubChem CID | 97228940 |
| Molecular Formula | C18H32N4 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-1-[(1R,3R)-3-methylcyclohexyl]piperidin-4-amine |
| SMILES | C[C@@H]1CCC[C@@H](N2CCC(NCCCn3ccnc3)CC2)C1 |
| InChI | InChI=1S/C18H32N4/c1-16-4-2-5-18(14-16)22-11-6-17(7-12-22)20-8-3-10-21-13-9-19-15-21/h9,13,15-18,20H,2-8,10-12,14H2,1H3/t16-,18-/m1/s1 |
| InChIKey | UCXAVMJGMOOOLO-SJLPKXTDSA-N |
| XLogP | 2.91 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|