C17H29N5O2 — CID 97228975
1-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-methylurea (PubChem CID 97228975) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-methylurea.
| Compound Name | 1-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-methylurea |
|---|---|
| PubChem CID | 97228975 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 1-[(1S,3R)-2,2-diethyl-3-methoxycyclobutyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-methylurea |
| SMILES | CCC1(CC)[C@@H](N(C)C(=O)NCc2nnc3n2CCC3)C[C@H]1OC |
| InChI | InChI=1S/C17H29N5O2/c1-5-17(6-2)12(10-13(17)24-4)21(3)16(23)18-11-15-20-19-14-8-7-9-22(14)15/h12-13H,5-11H2,1-4H3,(H,18,23)/t12-,13+/m0/s1 |
| InChIKey | KSYRVNNBFYGQNF-QWHCGFSZSA-N |
| XLogP | 1.96 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |