C17H24N4O5 — CID 97229164
(5S)-3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-6,6,8,8-tetramethyl-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 97229164) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (5S)-3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-6,6,8,8-tetramethyl-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-6,6,8,8-tetramethyl-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 97229164 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (5S)-3-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-6,6,8,8-tetramethyl-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cn1c(CN2C(=O)N[C@]3(CC(C)(C)OC3(C)C)C2=O)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C17H24N4O5/c1-15(2)9-17(16(3,4)26-15)12(23)21(13(24)18-17)8-10-7-11(22)20(6)14(25)19(10)5/h7H,8-9H2,1-6H3,(H,18,24)/t17-/m1/s1 |
| InChIKey | LZDUGDCUIKQOCR-QGZVFWFLSA-N |
| XLogP | -0.15 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|