C16H26N2O3S — CID 97230865
N-[2-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 97230865) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[2-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97230865 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[2-[[(3S)-2,2,5,5-tetramethyloxolan-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CC1(C)C[C@H](NCCNS(=O)(=O)c2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C16H26N2O3S/c1-15(2)12-14(16(3,4)21-15)17-10-11-18-22(19,20)13-8-6-5-7-9-13/h5-9,14,17-18H,10-12H2,1-4H3/t14-/m0/s1 |
| InChIKey | GINWRWFHTLVAKF-AWEZNQCLSA-N |
| XLogP | 1.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|