C17H22N2OS — CID 97230970
1-[4-[[(4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]amino]butyl]pyridin-2-one (PubChem CID 97230970) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 1-[4-[[(4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]amino]butyl]pyridin-2-one.
| Compound Name | 1-[4-[[(4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]amino]butyl]pyridin-2-one |
|---|---|
| PubChem CID | 97230970 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[4-[[(4S)-4,5,6,7-tetrahydro-1-benzothiophen-4-yl]amino]butyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCCCN[C@H]1CCCc2sccc21 |
| InChI | InChI=1S/C17H22N2OS/c20-17-8-1-3-11-19(17)12-4-2-10-18-15-6-5-7-16-14(15)9-13-21-16/h1,3,8-9,11,13,15,18H,2,4-7,10,12H2/t15-/m0/s1 |
| InChIKey | YYLROGANQRUIBQ-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|