C19H32N4O2 — CID 97231547
1-(4-cycloheptyloxybutyl)-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea (PubChem CID 97231547) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-(4-cycloheptyloxybutyl)-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea.
| Compound Name | 1-(4-cycloheptyloxybutyl)-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea |
|---|---|
| PubChem CID | 97231547 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 1-(4-cycloheptyloxybutyl)-3-[(7S)-4,5,6,7-tetrahydro-1H-indazol-7-yl]urea |
| SMILES | O=C(NCCCCOC1CCCCCC1)N[C@H]1CCCc2cn[nH]c21 |
| InChI | InChI=1S/C19H32N4O2/c24-19(22-17-11-7-8-15-14-21-23-18(15)17)20-12-5-6-13-25-16-9-3-1-2-4-10-16/h14,16-17H,1-13H2,(H,21,23)(H2,20,22,24)/t17-/m0/s1 |
| InChIKey | NOBSZTIHLAUNOJ-KRWDZBQOSA-N |
| XLogP | 3.61 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|