About (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol
(1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 97231606) has the molecular formula C18H28N2O
and a molecular weight of 288.44 g/mol. Its IUPAC name is (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 97231606 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | CC(C)CN1CCC(N[C@H]2CCc3c(O)cccc32)CC1 |
| InChI | InChI=1S/C18H28N2O/c1-13(2)12-20-10-8-14(9-11-20)19-17-7-6-16-15(17)4-3-5-18(16)21/h3-5,13-14,17,19,21H,6-12H2,1-2H3/t17-/m0/s1 |
| InChIKey | OPHFZYNZMJOWHF-KRWDZBQOSA-N |
| XLogP | 3.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol (CID 97231606) is (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol is CC(C)CN1CCC(N[C@H]2CCc3c(O)cccc32)CC1.
What is the InChIKey of (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol?
The InChIKey is OPHFZYNZMJOWHF-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H28N2O/c1-13(2)12-20-10-8-14(9-11-20)19-17-7-6-16-15(17)4-3-5-18(16)21/h3-5,13-14,17,19,21H,6-12H2,1-2H3/t17-/m0/s1.
What are the key properties of (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol?
(1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol has a molecular weight of 288.44 g/mol, XLogP of 3.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[[1-(2-methylpropyl)piperidin-4-yl]amino]-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 97231606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).