About ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate
ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate (PubChem CID 97232682) has the molecular formula C15H22N4O4S
and a molecular weight of 354.43 g/mol. Its IUPAC name is ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate.
Molecular Properties
| Compound Name | ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate |
| PubChem CID | 97232682 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)n1cc(NC(=O)[C@@H]2CSCN2C(C)=O)cn1 |
| InChI | InChI=1S/C15H22N4O4S/c1-5-23-14(22)15(3,4)19-7-11(6-16-19)17-13(21)12-8-24-9-18(12)10(2)20/h6-7,12H,5,8-9H2,1-4H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | IDBKHEFBQYIZTE-LBPRGKRZSA-N |
| XLogP | 1.04 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate?
The IUPAC name of ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate (CID 97232682) is ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate.
What is the SMILES notation for ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate?
The canonical SMILES for ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate is CCOC(=O)C(C)(C)n1cc(NC(=O)[C@@H]2CSCN2C(C)=O)cn1.
What is the InChIKey of ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate?
The InChIKey is IDBKHEFBQYIZTE-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H22N4O4S/c1-5-23-14(22)15(3,4)19-7-11(6-16-19)17-13(21)12-8-24-9-18(12)10(2)20/h6-7,12H,5,8-9H2,1-4H3,(H,17,21)/t12-/m0/s1.
What are the key properties of ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate?
ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate has a molecular weight of 354.43 g/mol, XLogP of 1.04, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[[(4R)-3-acetyl-1,3-thiazolidine-4-carbonyl]amino]pyrazol-1-yl]-2-methylpropanoate is sourced from PubChem (CID 97232682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).