C18H28N2O2S — CID 97233121
(3R)-3-[[(3S)-3-hydroxythiolan-3-yl]methylamino]-N-(2-propan-2-ylphenyl)butanamide (PubChem CID 97233121) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is (3R)-3-[[(3S)-3-hydroxythiolan-3-yl]methylamino]-N-(2-propan-2-ylphenyl)butanamide.
| Compound Name | (3R)-3-[[(3S)-3-hydroxythiolan-3-yl]methylamino]-N-(2-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 97233121 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (3R)-3-[[(3S)-3-hydroxythiolan-3-yl]methylamino]-N-(2-propan-2-ylphenyl)butanamide |
| SMILES | CC(C)c1ccccc1NC(=O)C[C@@H](C)NC[C@@]1(O)CCSC1 |
| InChI | InChI=1S/C18H28N2O2S/c1-13(2)15-6-4-5-7-16(15)20-17(21)10-14(3)19-11-18(22)8-9-23-12-18/h4-7,13-14,19,22H,8-12H2,1-3H3,(H,20,21)/t14-,18+/m1/s1 |
| InChIKey | FQSOXKVNBJJTKJ-KDOFPFPSSA-N |
| XLogP | 2.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |