C14H27NO2 — CID 97233273
(1S)-2,2-dimethyl-N-[3-[(3S)-oxolan-3-yl]oxypropyl]cyclopentan-1-amine (PubChem CID 97233273) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-N-[3-[(3S)-oxolan-3-yl]oxypropyl]cyclopentan-1-amine.
| Compound Name | (1S)-2,2-dimethyl-N-[3-[(3S)-oxolan-3-yl]oxypropyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 97233273 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (1S)-2,2-dimethyl-N-[3-[(3S)-oxolan-3-yl]oxypropyl]cyclopentan-1-amine |
| SMILES | CC1(C)CCC[C@@H]1NCCCO[C@H]1CCOC1 |
| InChI | InChI=1S/C14H27NO2/c1-14(2)7-3-5-13(14)15-8-4-9-17-12-6-10-16-11-12/h12-13,15H,3-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | SDZXPSCUEVAPNU-STQMWFEESA-N |
| XLogP | 2.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|