C18H22N2OS — CID 97234841
(5R,9S)-N-(quinolin-8-ylmethyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine (PubChem CID 97234841) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is (5R,9S)-N-(quinolin-8-ylmethyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine.
| Compound Name | (5R,9S)-N-(quinolin-8-ylmethyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
|---|---|
| PubChem CID | 97234841 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (5R,9S)-N-(quinolin-8-ylmethyl)-6-oxa-2-thiaspiro[4.5]decan-9-amine |
| SMILES | c1cnc2c(CN[C@H]3CCO[C@@]4(CCSC4)C3)cccc2c1 |
| InChI | InChI=1S/C18H22N2OS/c1-3-14-5-2-8-19-17(14)15(4-1)12-20-16-6-9-21-18(11-16)7-10-22-13-18/h1-5,8,16,20H,6-7,9-13H2/t16-,18-/m0/s1 |
| InChIKey | MPVQXOWPHVXIMM-WMZOPIPTSA-N |
| XLogP | 3.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |