C19H33N3O2 — CID 97235500
1-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea (PubChem CID 97235500) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is 1-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea.
| Compound Name | 1-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea |
|---|---|
| PubChem CID | 97235500 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 1-[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(4R)-1-oxaspiro[5.5]undecan-4-yl]urea |
| SMILES | O=C(N[C@@H]1CCOC2(CCCCC2)C1)N[C@@H]1CCN2CCCC[C@H]12 |
| InChI | InChI=1S/C19H33N3O2/c23-18(21-16-7-12-22-11-5-2-6-17(16)22)20-15-8-13-24-19(14-15)9-3-1-4-10-19/h15-17H,1-14H2,(H2,20,21,23)/t15-,16-,17-/m1/s1 |
| InChIKey | MZXBUJIFYZCVIY-BRWVUGGUSA-N |
| XLogP | 2.79 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |