About [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate
[(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate (PubChem CID 97236827) has the molecular formula C18H22N4O2
and a molecular weight of 326.40 g/mol. Its IUPAC name is [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate.
Molecular Properties
| Compound Name | [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate |
| PubChem CID | 97236827 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate |
| SMILES | CCN(CC)CC#C[C@@H](C)OC(=O)c1ccc(-n2cnnc2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c1-4-21(5-2)12-6-7-15(3)24-18(23)16-8-10-17(11-9-16)22-13-19-20-14-22/h8-11,13-15H,4-5,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | FQXPXSWCRYIZJO-OAHLLOKOSA-N |
| XLogP | 2.16 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate?
The IUPAC name of [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate (CID 97236827) is [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate.
What is the SMILES notation for [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate?
The canonical SMILES for [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate is CCN(CC)CC#C[C@@H](C)OC(=O)c1ccc(-n2cnnc2)cc1.
What is the InChIKey of [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate?
The InChIKey is FQXPXSWCRYIZJO-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H22N4O2/c1-4-21(5-2)12-6-7-15(3)24-18(23)16-8-10-17(11-9-16)22-13-19-20-14-22/h8-11,13-15H,4-5,12H2,1-3H3/t15-/m1/s1.
What are the key properties of [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate?
[(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate has a molecular weight of 326.40 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-5-(diethylamino)pent-3-yn-2-yl] 4-(1,2,4-triazol-4-yl)benzoate is sourced from PubChem (CID 97236827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).