C16H25N3O2 — CID 97236833
[(2R)-5-(diethylamino)pent-3-yn-2-yl] 1,3,5-trimethylpyrazole-4-carboxylate (PubChem CID 97236833) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is [(2R)-5-(diethylamino)pent-3-yn-2-yl] 1,3,5-trimethylpyrazole-4-carboxylate.
| Compound Name | [(2R)-5-(diethylamino)pent-3-yn-2-yl] 1,3,5-trimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 97236833 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | [(2R)-5-(diethylamino)pent-3-yn-2-yl] 1,3,5-trimethylpyrazole-4-carboxylate |
| SMILES | CCN(CC)CC#C[C@@H](C)OC(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C16H25N3O2/c1-7-19(8-2)11-9-10-12(3)21-16(20)15-13(4)17-18(6)14(15)5/h12H,7-8,11H2,1-6H3/t12-/m1/s1 |
| InChIKey | KBQAMGKIEKRJRS-GFCCVEGCSA-N |
| XLogP | 1.93 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|