C18H17F5N2O3S — CID 97237947
2,3,4,5,6-pentafluoro-N-[[(3S)-1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide (PubChem CID 97237947) has the molecular formula C18H17F5N2O3S and a molecular weight of 436.40 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[[(3S)-1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[[(3S)-1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97237947 |
| Molecular Formula | C18H17F5N2O3S |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[[(3S)-1-(2-methoxyphenyl)pyrrolidin-3-yl]methyl]benzenesulfonamide |
| SMILES | COc1ccccc1N1CC[C@H](CNS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C18H17F5N2O3S/c1-28-12-5-3-2-4-11(12)25-7-6-10(9-25)8-24-29(26,27)18-16(22)14(20)13(19)15(21)17(18)23/h2-5,10,24H,6-9H2,1H3/t10-/m1/s1 |
| InChIKey | PGMMHVJABAMKMN-SNVBAGLBSA-N |
| XLogP | 3.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|