C19H15F2NO3 — CID 97238178
(2S)-2-(3,4-difluorophenoxy)-N-(7-hydroxynaphthalen-1-yl)propanamide (PubChem CID 97238178) has the molecular formula C19H15F2NO3 and a molecular weight of 343.33 g/mol. Its IUPAC name is (2S)-2-(3,4-difluorophenoxy)-N-(7-hydroxynaphthalen-1-yl)propanamide.
| Compound Name | (2S)-2-(3,4-difluorophenoxy)-N-(7-hydroxynaphthalen-1-yl)propanamide |
|---|---|
| PubChem CID | 97238178 |
| Molecular Formula | C19H15F2NO3 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (2S)-2-(3,4-difluorophenoxy)-N-(7-hydroxynaphthalen-1-yl)propanamide |
| SMILES | C[C@H](Oc1ccc(F)c(F)c1)C(=O)Nc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C19H15F2NO3/c1-11(25-14-7-8-16(20)17(21)10-14)19(24)22-18-4-2-3-12-5-6-13(23)9-15(12)18/h2-11,23H,1H3,(H,22,24)/t11-/m0/s1 |
| InChIKey | IDTBXDSXXPOXAA-NSHDSACASA-N |
| XLogP | 4.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |