C13H15ClO4 — CID 97239053
[(2S,3S)-4-methoxy-3-methyl-4-oxobutan-2-yl] 3-chlorobenzoate (PubChem CID 97239053) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is [(2S,3S)-4-methoxy-3-methyl-4-oxobutan-2-yl] 3-chlorobenzoate.
| Compound Name | [(2S,3S)-4-methoxy-3-methyl-4-oxobutan-2-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 97239053 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [(2S,3S)-4-methoxy-3-methyl-4-oxobutan-2-yl] 3-chlorobenzoate |
| SMILES | COC(=O)[C@@H](C)[C@H](C)OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H15ClO4/c1-8(12(15)17-3)9(2)18-13(16)10-5-4-6-11(14)7-10/h4-9H,1-3H3/t8-,9-/m0/s1 |
| InChIKey | UEGZNMYRKJNYLI-IUCAKERBSA-N |
| XLogP | 2.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |