C11H21N3O3S — CID 97239341
N-[(2R)-2-hydroxypentyl]-1-propan-2-ylpyrazole-4-sulfonamide (PubChem CID 97239341) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypentyl]-1-propan-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-[(2R)-2-hydroxypentyl]-1-propan-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 97239341 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[(2R)-2-hydroxypentyl]-1-propan-2-ylpyrazole-4-sulfonamide |
| SMILES | CCC[C@@H](O)CNS(=O)(=O)c1cnn(C(C)C)c1 |
| InChI | InChI=1S/C11H21N3O3S/c1-4-5-10(15)6-13-18(16,17)11-7-12-14(8-11)9(2)3/h7-10,13,15H,4-6H2,1-3H3/t10-/m1/s1 |
| InChIKey | QJMSOGHFVFKUEW-SNVBAGLBSA-N |
| XLogP | 0.90 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |