C14H22N2O2 — CID 97239385
1,1-diethyl-3-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]urea (PubChem CID 97239385) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1,1-diethyl-3-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]urea.
| Compound Name | 1,1-diethyl-3-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 97239385 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1,1-diethyl-3-[(2R)-2-hydroxy-2-(2-methylphenyl)ethyl]urea |
| SMILES | CCN(CC)C(=O)NC[C@H](O)c1ccccc1C |
| InChI | InChI=1S/C14H22N2O2/c1-4-16(5-2)14(18)15-10-13(17)12-9-7-6-8-11(12)3/h6-9,13,17H,4-5,10H2,1-3H3,(H,15,18)/t13-/m0/s1 |
| InChIKey | KTWOBGDUQIAGEI-ZDUSSCGKSA-N |
| XLogP | 2.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |