About 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile
4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile (PubChem CID 97239633) has the molecular formula C13H15ClN2O3S2
and a molecular weight of 346.86 g/mol. Its IUPAC name is 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile.
Molecular Properties
| Compound Name | 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile |
| PubChem CID | 97239633 |
| Molecular Formula | C13H15ClN2O3S2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile |
| SMILES | CC1(C)CN(S(=O)(=O)c2cc(Cl)ccc2C#N)CC[S@]1=O |
| InChI | InChI=1S/C13H15ClN2O3S2/c1-13(2)9-16(5-6-20(13)17)21(18,19)12-7-11(14)4-3-10(12)8-15/h3-4,7H,5-6,9H2,1-2H3/t20-/m1/s1 |
| InChIKey | YXNZIILSUILVBM-HXUWFJFHSA-N |
| XLogP | 1.74 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile?
The IUPAC name of 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile (CID 97239633) is 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile.
What is the SMILES notation for 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile?
The canonical SMILES for 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile is CC1(C)CN(S(=O)(=O)c2cc(Cl)ccc2C#N)CC[S@]1=O.
What is the InChIKey of 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile?
The InChIKey is YXNZIILSUILVBM-HXUWFJFHSA-N. The full InChI is InChI=1S/C13H15ClN2O3S2/c1-13(2)9-16(5-6-20(13)17)21(18,19)12-7-11(14)4-3-10(12)8-15/h3-4,7H,5-6,9H2,1-2H3/t20-/m1/s1.
What are the key properties of 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile?
4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile has a molecular weight of 346.86 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[[(1R)-2,2-dimethyl-1-oxo-1,4-thiazinan-4-yl]sulfonyl]benzonitrile is sourced from PubChem (CID 97239633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).