C14H25NO — CID 97240106
[(1S,2S)-2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1-methylcyclopentyl]methanol (PubChem CID 97240106) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is [(1S,2S)-2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1-methylcyclopentyl]methanol.
| Compound Name | [(1S,2S)-2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 97240106 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | [(1S,2S)-2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1-methylcyclopentyl]methanol |
| SMILES | C[C@]1(CO)CCC[C@@H]1NC[C@H]1CC=CCC1 |
| InChI | InChI=1S/C14H25NO/c1-14(11-16)9-5-8-13(14)15-10-12-6-3-2-4-7-12/h2-3,12-13,15-16H,4-11H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | QXBYIUQPTPHDFP-MELADBBJSA-N |
| XLogP | 2.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|