C17H15F3N2O3 — CID 97241343
[(2R,4R)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone (PubChem CID 97241343) has the molecular formula C17H15F3N2O3 and a molecular weight of 352.31 g/mol. Its IUPAC name is [(2R,4R)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone.
| Compound Name | [(2R,4R)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone |
|---|---|
| PubChem CID | 97241343 |
| Molecular Formula | C17H15F3N2O3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [(2R,4R)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone |
| SMILES | O=C(c1cccc[n+]1[O-])N1C[C@H](O)C[C@@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H15F3N2O3/c18-17(19,20)12-5-3-4-11(8-12)15-9-13(23)10-21(15)16(24)14-6-1-2-7-22(14)25/h1-8,13,15,23H,9-10H2/t13-,15-/m1/s1 |
| InChIKey | KHHBVSDLFDCERC-UKRRQHHQSA-N |
| XLogP | 2.29 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|