C15H17F3N4O2 — CID 97241404
1-[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea (PubChem CID 97241404) has the molecular formula C15H17F3N4O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea.
| Compound Name | 1-[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 97241404 |
| Molecular Formula | C15H17F3N4O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-[(1R)-2-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-(2-propan-2-ylpyrazol-3-yl)urea |
| SMILES | CC(C)n1nccc1NC(=O)N[C@@H](CO)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H17F3N4O2/c1-8(2)22-13(3-4-19-22)21-15(24)20-12(7-23)9-5-10(16)14(18)11(17)6-9/h3-6,8,12,23H,7H2,1-2H3,(H2,20,21,24)/t12-/m0/s1 |
| InChIKey | DVKMURCSDLFHCN-LBPRGKRZSA-N |
| XLogP | 2.74 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|