C15H23F3N2O2 — CID 97241646
(3S)-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 97241646) has the molecular formula C15H23F3N2O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is (3S)-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 97241646 |
| Molecular Formula | C15H23F3N2O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3S)-N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCC1=CCOCC1)[C@H]1CCCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C15H23F3N2O2/c16-15(17,18)11-20-7-1-2-13(10-20)14(21)19-6-3-12-4-8-22-9-5-12/h4,13H,1-3,5-11H2,(H,19,21)/t13-/m0/s1 |
| InChIKey | FWVMFPHMRWJJBT-ZDUSSCGKSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|