C23H24N4OS — CID 97242117
(4aR,8aR)-1-cyclopropyl-6-(2-thiophen-2-ylquinazolin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 97242117) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is (4aR,8aR)-1-cyclopropyl-6-(2-thiophen-2-ylquinazolin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aR)-1-cyclopropyl-6-(2-thiophen-2-ylquinazolin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 97242117 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (4aR,8aR)-1-cyclopropyl-6-(2-thiophen-2-ylquinazolin-4-yl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | O=C1CC[C@@H]2CN(c3nc(-c4cccs4)nc4ccccc34)CC[C@H]2N1C1CC1 |
| InChI | InChI=1S/C23H24N4OS/c28-21-10-7-15-14-26(12-11-19(15)27(21)16-8-9-16)23-17-4-1-2-5-18(17)24-22(25-23)20-6-3-13-29-20/h1-6,13,15-16,19H,7-12,14H2/t15-,19-/m1/s1 |
| InChIKey | VKESIANGBSUBAG-DNVCBOLYSA-N |
| XLogP | 4.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |