C13H16FNO3 — CID 97243041
2-(2-fluorophenyl)-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide (PubChem CID 97243041) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 97243041 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[[(3S)-3-hydroxyoxolan-3-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccccc1F)NC[C@@]1(O)CCOC1 |
| InChI | InChI=1S/C13H16FNO3/c14-11-4-2-1-3-10(11)7-12(16)15-8-13(17)5-6-18-9-13/h1-4,17H,5-9H2,(H,15,16)/t13-/m0/s1 |
| InChIKey | IMWCBDNUMKFWOA-ZDUSSCGKSA-N |
| XLogP | 0.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |