C16H18N4O2 — CID 97243294
1-[(2R)-2-hydroxy-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]-1,2,4-triazole-3-carbonitrile (PubChem CID 97243294) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-[(2R)-2-hydroxy-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 97243294 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]propyl]-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(C[C@@H](O)CO[C@H]2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C16H18N4O2/c17-8-16-18-11-20(19-16)9-13(21)10-22-15-7-3-5-12-4-1-2-6-14(12)15/h1-2,4,6,11,13,15,21H,3,5,7,9-10H2/t13-,15+/m1/s1 |
| InChIKey | XIBUBIVPDLNXBX-HIFRSBDPSA-N |
| XLogP | 1.60 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |