About (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide
(2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide (PubChem CID 97243786) has the molecular formula C19H27NO2
and a molecular weight of 301.43 g/mol. Its IUPAC name is (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide.
Molecular Properties
| Compound Name | (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide |
| PubChem CID | 97243786 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide |
| SMILES | C[C@H](C(=O)N[C@@]1(C)CCc2ccccc2C1)C1CCOCC1 |
| InChI | InChI=1S/C19H27NO2/c1-14(15-8-11-22-12-9-15)18(21)20-19(2)10-7-16-5-3-4-6-17(16)13-19/h3-6,14-15H,7-13H2,1-2H3,(H,20,21)/t14-,19-/m0/s1 |
| InChIKey | GUECHZVALNAWRM-LIRRHRJNSA-N |
| XLogP | 3.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide?
The IUPAC name of (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide (CID 97243786) is (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide.
What is the SMILES notation for (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide?
The canonical SMILES for (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide is C[C@H](C(=O)N[C@@]1(C)CCc2ccccc2C1)C1CCOCC1.
What is the InChIKey of (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide?
The InChIKey is GUECHZVALNAWRM-LIRRHRJNSA-N. The full InChI is InChI=1S/C19H27NO2/c1-14(15-8-11-22-12-9-15)18(21)20-19(2)10-7-16-5-3-4-6-17(16)13-19/h3-6,14-15H,7-13H2,1-2H3,(H,20,21)/t14-,19-/m0/s1.
What are the key properties of (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide?
(2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide has a molecular weight of 301.43 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(2S)-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-2-(oxan-4-yl)propanamide is sourced from PubChem (CID 97243786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).