C13H20F3NO — CID 97244732
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4,4-trifluorobutan-1-one (PubChem CID 97244732) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 97244732 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C13H20F3NO/c14-13(15,16)8-7-12(18)17-9-3-5-10-4-1-2-6-11(10)17/h10-11H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | XKOBLIVHLWYVNY-GHMZBOCLSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |