C14H17FN2O4 — CID 97244740
(3S)-4-acetyl-N-(3-fluoro-4-methoxyphenyl)morpholine-3-carboxamide (PubChem CID 97244740) has the molecular formula C14H17FN2O4 and a molecular weight of 296.30 g/mol. Its IUPAC name is (3S)-4-acetyl-N-(3-fluoro-4-methoxyphenyl)morpholine-3-carboxamide.
| Compound Name | (3S)-4-acetyl-N-(3-fluoro-4-methoxyphenyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 97244740 |
| Molecular Formula | C14H17FN2O4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (3S)-4-acetyl-N-(3-fluoro-4-methoxyphenyl)morpholine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2COCCN2C(C)=O)cc1F |
| InChI | InChI=1S/C14H17FN2O4/c1-9(18)17-5-6-21-8-12(17)14(19)16-10-3-4-13(20-2)11(15)7-10/h3-4,7,12H,5-6,8H2,1-2H3,(H,16,19)/t12-/m0/s1 |
| InChIKey | OGGZOGMOBMEYTK-LBPRGKRZSA-N |
| XLogP | 1.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |