About 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 97245569) has the molecular formula C16H21FN2O4S
and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea.
Molecular Properties
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea |
| PubChem CID | 97245569 |
| Molecular Formula | C16H21FN2O4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(Nc1cccc(F)c1)N(C[C@H]1CCCO1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H21FN2O4S/c17-12-3-1-4-13(9-12)18-16(20)19(10-15-5-2-7-23-15)14-6-8-24(21,22)11-14/h1,3-4,9,14-15H,2,5-8,10-11H2,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | SICMOZNVDVUPDH-HUUCEWRRSA-N |
| XLogP | 2.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea?
The IUPAC name of 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea (CID 97245569) is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea.
What is the SMILES notation for 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea?
The canonical SMILES for 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea is O=C(Nc1cccc(F)c1)N(C[C@H]1CCCO1)[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea?
The InChIKey is SICMOZNVDVUPDH-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H21FN2O4S/c17-12-3-1-4-13(9-12)18-16(20)19(10-15-5-2-7-23-15)14-6-8-24(21,22)11-14/h1,3-4,9,14-15H,2,5-8,10-11H2,(H,18,20)/t14-,15-/m1/s1.
What are the key properties of 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea?
1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea has a molecular weight of 356.42 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-1,1-dioxothiolan-3-yl]-3-(3-fluorophenyl)-1-[[(2R)-oxolan-2-yl]methyl]urea is sourced from PubChem (CID 97245569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).