C16H21N3O3S — CID 97246004
5-methyl-1-[2-[(2S)-oxan-2-yl]oxyethyl]-N-thiophen-3-ylpyrazole-4-carboxamide (PubChem CID 97246004) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 5-methyl-1-[2-[(2S)-oxan-2-yl]oxyethyl]-N-thiophen-3-ylpyrazole-4-carboxamide.
| Compound Name | 5-methyl-1-[2-[(2S)-oxan-2-yl]oxyethyl]-N-thiophen-3-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 97246004 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 5-methyl-1-[2-[(2S)-oxan-2-yl]oxyethyl]-N-thiophen-3-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccsc2)cnn1CCO[C@H]1CCCCO1 |
| InChI | InChI=1S/C16H21N3O3S/c1-12-14(16(20)18-13-5-9-23-11-13)10-17-19(12)6-8-22-15-4-2-3-7-21-15/h5,9-11,15H,2-4,6-8H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | MZJJPRDOEBNKFB-HNNXBMFYSA-N |
| XLogP | 3.05 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |