C13H13Cl2NO4S — CID 97246615
(3aS,7aR)-1-(3,4-dichlorophenyl)sulfonyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one (PubChem CID 97246615) has the molecular formula C13H13Cl2NO4S and a molecular weight of 350.22 g/mol. Its IUPAC name is (3aS,7aR)-1-(3,4-dichlorophenyl)sulfonyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one.
| Compound Name | (3aS,7aR)-1-(3,4-dichlorophenyl)sulfonyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
|---|---|
| PubChem CID | 97246615 |
| Molecular Formula | C13H13Cl2NO4S |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (3aS,7aR)-1-(3,4-dichlorophenyl)sulfonyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
| SMILES | O=C1OCC[C@@H]2CCN(S(=O)(=O)c3ccc(Cl)c(Cl)c3)[C@@H]12 |
| InChI | InChI=1S/C13H13Cl2NO4S/c14-10-2-1-9(7-11(10)15)21(18,19)16-5-3-8-4-6-20-13(17)12(8)16/h1-2,7-8,12H,3-6H2/t8-,12+/m0/s1 |
| InChIKey | CDTBRXKVWYUOED-QPUJVOFHSA-N |
| XLogP | 2.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |