C11H12BrNO2 — CID 97247026
(2S)-N-(4-bromo-2-methylphenyl)oxetane-2-carboxamide (PubChem CID 97247026) has the molecular formula C11H12BrNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is (2S)-N-(4-bromo-2-methylphenyl)oxetane-2-carboxamide.
| Compound Name | (2S)-N-(4-bromo-2-methylphenyl)oxetane-2-carboxamide |
|---|---|
| PubChem CID | 97247026 |
| Molecular Formula | C11H12BrNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | (2S)-N-(4-bromo-2-methylphenyl)oxetane-2-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)[C@@H]1CCO1 |
| InChI | InChI=1S/C11H12BrNO2/c1-7-6-8(12)2-3-9(7)13-11(14)10-4-5-15-10/h2-3,6,10H,4-5H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | DUVSALCVYACDKV-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |