C12H10F4N2O — CID 972477
2-[1-methyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol (PubChem CID 972477) has the molecular formula C12H10F4N2O and a molecular weight of 274.22 g/mol. Its IUPAC name is 2-[1-methyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol.
| Compound Name | 2-[1-methyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 972477 |
| Molecular Formula | C12H10F4N2O |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[1-methyl-3-(1,1,2,2-tetrafluoroethyl)pyrazol-5-yl]phenol |
| SMILES | Cn1nc(C(F)(F)C(F)F)cc1-c1ccccc1O |
| InChI | InChI=1S/C12H10F4N2O/c1-18-8(7-4-2-3-5-9(7)19)6-10(17-18)12(15,16)11(13)14/h2-6,11,19H,1H3 |
| InChIKey | RGMWBWUILUOXPL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|