About [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate
[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate (PubChem CID 972479) has the molecular formula C19H17NO4
and a molecular weight of 323.35 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate |
| PubChem CID | 972479 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(N3C(=O)CCC3=O)c(C)c2)cc1 |
| InChI | InChI=1S/C19H17NO4/c1-12-3-5-14(6-4-12)19(23)24-15-7-8-16(13(2)11-15)20-17(21)9-10-18(20)22/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | MUHJXLDDLBONSW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate?
The IUPAC name of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate (CID 972479) is [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate.
What is the SMILES notation for [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate?
The canonical SMILES for [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate is Cc1ccc(C(=O)Oc2ccc(N3C(=O)CCC3=O)c(C)c2)cc1.
What is the InChIKey of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate?
The InChIKey is MUHJXLDDLBONSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO4/c1-12-3-5-14(6-4-12)19(23)24-15-7-8-16(13(2)11-15)20-17(21)9-10-18(20)22/h3-8,11H,9-10H2,1-2H3.
What are the key properties of [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate?
[4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate has a molecular weight of 323.35 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,5-dioxopyrrolidin-1-yl)-3-methylphenyl] 4-methylbenzoate is sourced from PubChem (CID 972479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).