C16H17ClN4O2 — CID 97248069
2-[(2R)-1-(5-chloropyridine-2-carbonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanone (PubChem CID 97248069) has the molecular formula C16H17ClN4O2 and a molecular weight of 332.79 g/mol. Its IUPAC name is 2-[(2R)-1-(5-chloropyridine-2-carbonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanone.
| Compound Name | 2-[(2R)-1-(5-chloropyridine-2-carbonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 97248069 |
| Molecular Formula | C16H17ClN4O2 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-[(2R)-1-(5-chloropyridine-2-carbonyl)pyrrolidin-2-yl]-1-(1-methylpyrazol-4-yl)ethanone |
| SMILES | Cn1cc(C(=O)C[C@H]2CCCN2C(=O)c2ccc(Cl)cn2)cn1 |
| InChI | InChI=1S/C16H17ClN4O2/c1-20-10-11(8-19-20)15(22)7-13-3-2-6-21(13)16(23)14-5-4-12(17)9-18-14/h4-5,8-10,13H,2-3,6-7H2,1H3/t13-/m1/s1 |
| InChIKey | XVYFCUWHLZLXTO-CYBMUJFWSA-N |
| XLogP | 2.35 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |