C18H19N3O2S — CID 97248156
2-[(3R)-4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)morpholin-3-yl]ethanol (PubChem CID 97248156) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-[(3R)-4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)morpholin-3-yl]ethanol.
| Compound Name | 2-[(3R)-4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)morpholin-3-yl]ethanol |
|---|---|
| PubChem CID | 97248156 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[(3R)-4-(5-phenylthieno[2,3-d]pyrimidin-4-yl)morpholin-3-yl]ethanol |
| SMILES | OCC[C@@H]1COCCN1c1ncnc2scc(-c3ccccc3)c12 |
| InChI | InChI=1S/C18H19N3O2S/c22-8-6-14-10-23-9-7-21(14)17-16-15(13-4-2-1-3-5-13)11-24-18(16)20-12-19-17/h1-5,11-12,14,22H,6-10H2/t14-/m1/s1 |
| InChIKey | YUQIFKLFVGWMHL-CQSZACIVSA-N |
| XLogP | 2.95 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |