C20H28N2O2 — CID 97248693
N-[(1S)-1-(4-methoxyphenyl)propyl]-2-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetamide (PubChem CID 97248693) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[(1S)-1-(4-methoxyphenyl)propyl]-2-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetamide.
| Compound Name | N-[(1S)-1-(4-methoxyphenyl)propyl]-2-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetamide |
|---|---|
| PubChem CID | 97248693 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | N-[(1S)-1-(4-methoxyphenyl)propyl]-2-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ylidene]acetamide |
| SMILES | CC[C@H](NC(=O)/C=C1/C[C@H]2CC[C@@H](C1)N2C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H28N2O2/c1-4-19(15-5-9-18(24-3)10-6-15)21-20(23)13-14-11-16-7-8-17(12-14)22(16)2/h5-6,9-10,13,16-17,19H,4,7-8,11-12H2,1-3H3,(H,21,23)/b14-13-/t16-,17+,19+/m1/s1 |
| InChIKey | UQOMVRGOXNDVBG-NRTNGJPUSA-N |
| XLogP | 3.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|