C18H18FNO3S — CID 97248736
3-ethylsulfonyl-N-[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]benzamide (PubChem CID 97248736) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-ethylsulfonyl-N-[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]benzamide.
| Compound Name | 3-ethylsulfonyl-N-[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]benzamide |
|---|---|
| PubChem CID | 97248736 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-ethylsulfonyl-N-[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]benzamide |
| SMILES | CCS(=O)(=O)c1cccc(C(=O)N[C@H]2CCc3c(F)cccc32)c1 |
| InChI | InChI=1S/C18H18FNO3S/c1-2-24(22,23)13-6-3-5-12(11-13)18(21)20-17-10-9-14-15(17)7-4-8-16(14)19/h3-8,11,17H,2,9-10H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | KOVGPTSTZBBQQM-KRWDZBQOSA-N |
| XLogP | 3.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |