About (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide
(2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide (PubChem CID 97248963) has the molecular formula C16H15F3N2O2S
and a molecular weight of 356.37 g/mol. Its IUPAC name is (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide.
Molecular Properties
| Compound Name | (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide |
| PubChem CID | 97248963 |
| Molecular Formula | C16H15F3N2O2S |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide |
| SMILES | C[C@@H](Oc1ccccc1C(F)(F)F)C(=O)Nc1scnc1C1CC1 |
| InChI | InChI=1S/C16H15F3N2O2S/c1-9(23-12-5-3-2-4-11(12)16(17,18)19)14(22)21-15-13(10-6-7-10)20-8-24-15/h2-5,8-10H,6-7H2,1H3,(H,21,22)/t9-/m1/s1 |
| InChIKey | VDNWASHKFMQFQZ-SECBINFHSA-N |
| XLogP | 4.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide?
The IUPAC name of (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide (CID 97248963) is (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide.
What is the SMILES notation for (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide?
The canonical SMILES for (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide is C[C@@H](Oc1ccccc1C(F)(F)F)C(=O)Nc1scnc1C1CC1.
What is the InChIKey of (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide?
The InChIKey is VDNWASHKFMQFQZ-SECBINFHSA-N. The full InChI is InChI=1S/C16H15F3N2O2S/c1-9(23-12-5-3-2-4-11(12)16(17,18)19)14(22)21-15-13(10-6-7-10)20-8-24-15/h2-5,8-10H,6-7H2,1H3,(H,21,22)/t9-/m1/s1.
What are the key properties of (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide?
(2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide has a molecular weight of 356.37 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(4-cyclopropyl-1,3-thiazol-5-yl)-2-[2-(trifluoromethyl)phenoxy]propanamide is sourced from PubChem (CID 97248963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).