C14H18FN3O — CID 97249720
(1S,3S)-1-(4-fluorophenyl)-3-(1H-imidazol-2-ylmethylamino)butan-1-ol (PubChem CID 97249720) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is (1S,3S)-1-(4-fluorophenyl)-3-(1H-imidazol-2-ylmethylamino)butan-1-ol.
| Compound Name | (1S,3S)-1-(4-fluorophenyl)-3-(1H-imidazol-2-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 97249720 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (1S,3S)-1-(4-fluorophenyl)-3-(1H-imidazol-2-ylmethylamino)butan-1-ol |
| SMILES | C[C@@H](C[C@H](O)c1ccc(F)cc1)NCc1ncc[nH]1 |
| InChI | InChI=1S/C14H18FN3O/c1-10(18-9-14-16-6-7-17-14)8-13(19)11-2-4-12(15)5-3-11/h2-7,10,13,18-19H,8-9H2,1H3,(H,16,17)/t10-,13-/m0/s1 |
| InChIKey | ROUPFYVOHGMUDC-GWCFXTLKSA-N |
| XLogP | 2.15 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |