About N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide
N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide (PubChem CID 97250439) has the molecular formula C17H23NO2S
and a molecular weight of 305.44 g/mol. Its IUPAC name is N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide |
| PubChem CID | 97250439 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide |
| SMILES | C[C@@H]1OCC[C@H]1NC(=O)C1(Sc2ccccc2)CCCC1 |
| InChI | InChI=1S/C17H23NO2S/c1-13-15(9-12-20-13)18-16(19)17(10-5-6-11-17)21-14-7-3-2-4-8-14/h2-4,7-8,13,15H,5-6,9-12H2,1H3,(H,18,19)/t13-,15+/m0/s1 |
| InChIKey | RYSIOUXTBIQNHJ-DZGCQCFKSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide?
The IUPAC name of N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide (CID 97250439) is N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide.
What is the SMILES notation for N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide?
The canonical SMILES for N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide is C[C@@H]1OCC[C@H]1NC(=O)C1(Sc2ccccc2)CCCC1.
What is the InChIKey of N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide?
The InChIKey is RYSIOUXTBIQNHJ-DZGCQCFKSA-N. The full InChI is InChI=1S/C17H23NO2S/c1-13-15(9-12-20-13)18-16(19)17(10-5-6-11-17)21-14-7-3-2-4-8-14/h2-4,7-8,13,15H,5-6,9-12H2,1H3,(H,18,19)/t13-,15+/m0/s1.
What are the key properties of N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide?
N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide has a molecular weight of 305.44 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3R)-2-methyloxolan-3-yl]-1-phenylsulfanylcyclopentane-1-carboxamide is sourced from PubChem (CID 97250439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).