About (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide
(3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide (PubChem CID 97250457) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide.
Molecular Properties
| Compound Name | (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide |
| PubChem CID | 97250457 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide |
| SMILES | Cc1n[nH]c(C)c1[C@@H](C)CC(=O)N[C@H]1CCCN(C)C1=O |
| InChI | InChI=1S/C15H24N4O2/c1-9(14-10(2)17-18-11(14)3)8-13(20)16-12-6-5-7-19(4)15(12)21/h9,12H,5-8H2,1-4H3,(H,16,20)(H,17,18)/t9-,12-/m0/s1 |
| InChIKey | RCMQJSIIDOYLBJ-CABZTGNLSA-N |
| XLogP | 1.26 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide?
The IUPAC name of (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide (CID 97250457) is (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide.
What is the SMILES notation for (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide?
The canonical SMILES for (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide is Cc1n[nH]c(C)c1[C@@H](C)CC(=O)N[C@H]1CCCN(C)C1=O.
What is the InChIKey of (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide?
The InChIKey is RCMQJSIIDOYLBJ-CABZTGNLSA-N. The full InChI is InChI=1S/C15H24N4O2/c1-9(14-10(2)17-18-11(14)3)8-13(20)16-12-6-5-7-19(4)15(12)21/h9,12H,5-8H2,1-4H3,(H,16,20)(H,17,18)/t9-,12-/m0/s1.
What are the key properties of (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide?
(3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide has a molecular weight of 292.38 g/mol, XLogP of 1.26, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(3S)-1-methyl-2-oxopiperidin-3-yl]butanamide is sourced from PubChem (CID 97250457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).