C16H14F3N3O — CID 97251116
N-[(S)-cyclopropyl-(4-methylpyrimidin-2-yl)methyl]-2,4,5-trifluorobenzamide (PubChem CID 97251116) has the molecular formula C16H14F3N3O and a molecular weight of 321.30 g/mol. Its IUPAC name is N-[(S)-cyclopropyl-(4-methylpyrimidin-2-yl)methyl]-2,4,5-trifluorobenzamide.
| Compound Name | N-[(S)-cyclopropyl-(4-methylpyrimidin-2-yl)methyl]-2,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 97251116 |
| Molecular Formula | C16H14F3N3O |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(S)-cyclopropyl-(4-methylpyrimidin-2-yl)methyl]-2,4,5-trifluorobenzamide |
| SMILES | Cc1ccnc([C@@H](NC(=O)c2cc(F)c(F)cc2F)C2CC2)n1 |
| InChI | InChI=1S/C16H14F3N3O/c1-8-4-5-20-15(21-8)14(9-2-3-9)22-16(23)10-6-12(18)13(19)7-11(10)17/h4-7,9,14H,2-3H2,1H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | AQFMCYUZCILJCL-AWEZNQCLSA-N |
| XLogP | 3.08 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|