C22H27NO3 — CID 97251410
N-[2-[(1S)-1-hydroxy-2-methylpropyl]phenyl]-3-(3-methylbut-2-enoxy)benzamide (PubChem CID 97251410) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is N-[2-[(1S)-1-hydroxy-2-methylpropyl]phenyl]-3-(3-methylbut-2-enoxy)benzamide.
| Compound Name | N-[2-[(1S)-1-hydroxy-2-methylpropyl]phenyl]-3-(3-methylbut-2-enoxy)benzamide |
|---|---|
| PubChem CID | 97251410 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[2-[(1S)-1-hydroxy-2-methylpropyl]phenyl]-3-(3-methylbut-2-enoxy)benzamide |
| SMILES | CC(C)=CCOc1cccc(C(=O)Nc2ccccc2[C@@H](O)C(C)C)c1 |
| InChI | InChI=1S/C22H27NO3/c1-15(2)12-13-26-18-9-7-8-17(14-18)22(25)23-20-11-6-5-10-19(20)21(24)16(3)4/h5-12,14,16,21,24H,13H2,1-4H3,(H,23,25)/t21-/m0/s1 |
| InChIKey | BHYJPNSQPBSXOK-NRFANRHFSA-N |
| XLogP | 4.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|