C14H20F3N5O — CID 97251620
(3R)-4-[4-(dimethylamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-propylpiperazin-2-one (PubChem CID 97251620) has the molecular formula C14H20F3N5O and a molecular weight of 331.34 g/mol. Its IUPAC name is (3R)-4-[4-(dimethylamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-propylpiperazin-2-one.
| Compound Name | (3R)-4-[4-(dimethylamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-propylpiperazin-2-one |
|---|---|
| PubChem CID | 97251620 |
| Molecular Formula | C14H20F3N5O |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3R)-4-[4-(dimethylamino)-6-(trifluoromethyl)pyrimidin-2-yl]-3-propylpiperazin-2-one |
| SMILES | CCC[C@@H]1C(=O)NCCN1c1nc(N(C)C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H20F3N5O/c1-4-5-9-12(23)18-6-7-22(9)13-19-10(14(15,16)17)8-11(20-13)21(2)3/h8-9H,4-7H2,1-3H3,(H,18,23)/t9-/m1/s1 |
| InChIKey | WGRJINBCMGKPLV-SECBINFHSA-N |
| XLogP | 1.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |