About methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate
methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 97252177) has the molecular formula C21H30N2O4
and a molecular weight of 374.48 g/mol. Its IUPAC name is methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
| PubChem CID | 97252177 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)CN2[C@@H](C)COC[C@H]2c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H30N2O4/c1-16-14-27-15-18(17-9-5-3-6-10-17)23(16)13-19(24)22-21(20(25)26-2)11-7-4-8-12-21/h3,5-6,9-10,16,18H,4,7-8,11-15H2,1-2H3,(H,22,24)/t16-,18-/m0/s1 |
| InChIKey | DPEHMGDLFJKVSG-WMZOPIPTSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate?
The IUPAC name of methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate (CID 97252177) is methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate.
What is the SMILES notation for methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate?
The canonical SMILES for methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate is COC(=O)C1(NC(=O)CN2[C@@H](C)COC[C@H]2c2ccccc2)CCCCC1.
What is the InChIKey of methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate?
The InChIKey is DPEHMGDLFJKVSG-WMZOPIPTSA-N. The full InChI is InChI=1S/C21H30N2O4/c1-16-14-27-15-18(17-9-5-3-6-10-17)23(16)13-19(24)22-21(20(25)26-2)11-7-4-8-12-21/h3,5-6,9-10,16,18H,4,7-8,11-15H2,1-2H3,(H,22,24)/t16-,18-/m0/s1.
What are the key properties of methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate?
methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate has a molecular weight of 374.48 g/mol, XLogP of 2.44, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[2-[(3S,5R)-3-methyl-5-phenylmorpholin-4-yl]acetyl]amino]cyclohexane-1-carboxylate is sourced from PubChem (CID 97252177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).